C29H57NO3 — CID 169317504
2-hexyldecyl 6-[cyclopentyl(2-hydroxyethyl)amino]hexanoate (PubChem CID 169317504) has the molecular formula C29H57NO3 and a molecular weight of 467.78 g/mol. Its IUPAC name is 2-hexyldecyl 6-[cyclopentyl(2-hydroxyethyl)amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[cyclopentyl(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 169317504 |
| Molecular Formula | C29H57NO3 |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 467.43 |
| IUPAC Name | 2-hexyldecyl 6-[cyclopentyl(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCO)C1CCCC1 |
| InChI | InChI=1S/C29H57NO3/c1-3-5-7-9-10-13-19-27(18-12-8-6-4-2)26-33-29(32)22-14-11-17-23-30(24-25-31)28-20-15-16-21-28/h27-28,31H,3-26H2,1-2H3 |
| InChIKey | XCEQAOXYNMVKOM-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|