C30H57F2NO3 — CID 169317747
2-octyldecyl 6-[(3,3-difluorocyclobutyl)-(2-hydroxyethyl)amino]hexanoate (PubChem CID 169317747) has the molecular formula C30H57F2NO3 and a molecular weight of 517.79 g/mol. Its IUPAC name is 2-octyldecyl 6-[(3,3-difluorocyclobutyl)-(2-hydroxyethyl)amino]hexanoate.
| Compound Name | 2-octyldecyl 6-[(3,3-difluorocyclobutyl)-(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 169317747 |
| Molecular Formula | C30H57F2NO3 |
| Molecular Weight | 517.79 g/mol |
| Exact Mass | 517.43 |
| IUPAC Name | 2-octyldecyl 6-[(3,3-difluorocyclobutyl)-(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)COC(=O)CCCCCN(CCO)C1CC(F)(F)C1 |
| InChI | InChI=1S/C30H57F2NO3/c1-3-5-7-9-11-14-18-27(19-15-12-10-8-6-4-2)26-36-29(35)20-16-13-17-21-33(22-23-34)28-24-30(31,32)25-28/h27-28,34H,3-26H2,1-2H3 |
| InChIKey | HNVBCEJSMWOARW-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.79 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|