C56H106N2O9 — CID 169317390
[6-[2-[cyclohexyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]ethyl-(2-hydroxyethyl)amino]-2-(octanoyloxymethyl)hexyl] octanoate (PubChem CID 169317390) has the molecular formula C56H106N2O9 and a molecular weight of 951.47 g/mol. Its IUPAC name is [6-[2-[cyclohexyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]ethyl-(2-hydroxyethyl)amino]-2-(octanoyloxymethyl)hexyl] octanoate.
| Compound Name | [6-[2-[cyclohexyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]ethyl-(2-hydroxyethyl)amino]-2-(octanoyloxymethyl)hexyl] octanoate |
|---|---|
| PubChem CID | 169317390 |
| Molecular Formula | C56H106N2O9 |
| Molecular Weight | 951.47 g/mol |
| Exact Mass | 950.79 |
| IUPAC Name | [6-[2-[cyclohexyl-[6-octanoyloxy-5-(octanoyloxymethyl)hexyl]amino]ethyl-(2-hydroxyethyl)amino]-2-(octanoyloxymethyl)hexyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(CCCCN(CCO)CCN(CCCCC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)C1CCCCC1)COC(=O)CCCCCCC |
| InChI | InChI=1S/C56H106N2O9/c1-5-9-13-17-24-36-53(60)64-46-50(47-65-54(61)37-25-18-14-10-6-2)32-28-30-40-57(44-45-59)42-43-58(52-34-22-21-23-35-52)41-31-29-33-51(48-66-55(62)38-26-19-15-11-7-3)49-67-56(63)39-27-20-16-12-8-4/h50-52,59H,5-49H2,1-4H3 |
| InChIKey | DAESTOJDVBEMSJ-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.47 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|