C66H122N2O5 — CID 169317376
[(Z)-2-[(Z)-dec-4-enyl]dodec-6-enyl] 6-[2-[cyclohexyl-[6-[(Z)-2-[(Z)-dec-4-enyl]dodec-6-enoxy]-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate (PubChem CID 169317376) has the molecular formula C66H122N2O5 and a molecular weight of 1023.71 g/mol. Its IUPAC name is [(Z)-2-[(Z)-dec-4-enyl]dodec-6-enyl] 6-[2-[cyclohexyl-[6-[(Z)-2-[(Z)-dec-4-enyl]dodec-6-enoxy]-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate.
| Compound Name | [(Z)-2-[(Z)-dec-4-enyl]dodec-6-enyl] 6-[2-[cyclohexyl-[6-[(Z)-2-[(Z)-dec-4-enyl]dodec-6-enoxy]-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 169317376 |
| Molecular Formula | C66H122N2O5 |
| Molecular Weight | 1023.71 g/mol |
| Exact Mass | 1022.94 |
| IUPAC Name | [(Z)-2-[(Z)-dec-4-enyl]dodec-6-enyl] 6-[2-[cyclohexyl-[6-[(Z)-2-[(Z)-dec-4-enyl]dodec-6-enoxy]-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCC/C=C\CCCC(CCC/C=C\CCCCC)COC(=O)CCCCCN(CCO)CCN(CCCCCC(=O)OCC(CCC/C=C\CCCCC)CCC/C=C\CCCCC)C1CCCCC1 |
| InChI | InChI=1S/C66H122N2O5/c1-5-9-13-17-21-25-29-36-46-62(47-37-30-26-22-18-14-10-6-2)60-72-65(70)52-42-34-44-54-67(58-59-69)56-57-68(64-50-40-33-41-51-64)55-45-35-43-53-66(71)73-61-63(48-38-31-27-23-19-15-11-7-3)49-39-32-28-24-20-16-12-8-4/h21-28,62-64,69H,5-20,29-61H2,1-4H3/b25-21-,26-22-,27-23-,28-24- |
| InChIKey | BILCTDASKRXWDK-VUMQXKEWSA-N |
| XLogP | 18.58 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.71 |
| LogP ≤ 5 | 18.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|