C57H111N3O6 — CID 170367496
[6-[4-[cyclohexyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]butyl-(2-hydroxyethyl)amino]-2-(octanoyloxymethyl)hexyl] octanoate (PubChem CID 170367496) has the molecular formula C57H111N3O6 and a molecular weight of 934.53 g/mol. Its IUPAC name is [6-[4-[cyclohexyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]butyl-(2-hydroxyethyl)amino]-2-(octanoyloxymethyl)hexyl] octanoate.
| Compound Name | [6-[4-[cyclohexyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]butyl-(2-hydroxyethyl)amino]-2-(octanoyloxymethyl)hexyl] octanoate |
|---|---|
| PubChem CID | 170367496 |
| Molecular Formula | C57H111N3O6 |
| Molecular Weight | 934.53 g/mol |
| Exact Mass | 933.85 |
| IUPAC Name | [6-[4-[cyclohexyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]butyl-(2-hydroxyethyl)amino]-2-(octanoyloxymethyl)hexyl] octanoate |
| SMILES | CCCCCCCCC(CCCCCC)CNC(=O)CCCCCN(CCCCN(CCO)CCCCC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)C1CCCCC1 |
| InChI | InChI=1S/C57H111N3O6/c1-5-9-13-17-20-24-36-52(35-23-16-12-8-4)49-58-55(62)40-27-22-31-45-60(54-38-25-21-26-39-54)46-34-33-44-59(47-48-61)43-32-30-37-53(50-65-56(63)41-28-18-14-10-6-2)51-66-57(64)42-29-19-15-11-7-3/h52-54,61H,5-51H2,1-4H3,(H,58,62) |
| InChIKey | BQVJWODIGQDNAI-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.53 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|