C30H60N2O2 — CID 169317754
6-[cyclobutyl(2-hydroxyethyl)amino]-N-(2-octyldecyl)hexanamide (PubChem CID 169317754) has the molecular formula C30H60N2O2 and a molecular weight of 480.82 g/mol. Its IUPAC name is 6-[cyclobutyl(2-hydroxyethyl)amino]-N-(2-octyldecyl)hexanamide.
| Compound Name | 6-[cyclobutyl(2-hydroxyethyl)amino]-N-(2-octyldecyl)hexanamide |
|---|---|
| PubChem CID | 169317754 |
| Molecular Formula | C30H60N2O2 |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.47 |
| IUPAC Name | 6-[cyclobutyl(2-hydroxyethyl)amino]-N-(2-octyldecyl)hexanamide |
| SMILES | CCCCCCCCC(CCCCCCCC)CNC(=O)CCCCCN(CCO)C1CCC1 |
| InChI | InChI=1S/C30H60N2O2/c1-3-5-7-9-11-14-19-28(20-15-12-10-8-6-4-2)27-31-30(34)23-16-13-17-24-32(25-26-33)29-21-18-22-29/h28-29,33H,3-27H2,1-2H3,(H,31,34) |
| InChIKey | AZNBEGMVTWBIFX-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|