C39H77N3O4 — CID 167171967
methyl 6-[2-[cyclobutyl(2-hydroxyethyl)amino]ethyl-[6-(2-octyldecylamino)-6-oxohexyl]amino]hexanoate (PubChem CID 167171967) has the molecular formula C39H77N3O4 and a molecular weight of 652.06 g/mol. Its IUPAC name is methyl 6-[2-[cyclobutyl(2-hydroxyethyl)amino]ethyl-[6-(2-octyldecylamino)-6-oxohexyl]amino]hexanoate.
| Compound Name | methyl 6-[2-[cyclobutyl(2-hydroxyethyl)amino]ethyl-[6-(2-octyldecylamino)-6-oxohexyl]amino]hexanoate |
|---|---|
| PubChem CID | 167171967 |
| Molecular Formula | C39H77N3O4 |
| Molecular Weight | 652.06 g/mol |
| Exact Mass | 651.59 |
| IUPAC Name | methyl 6-[2-[cyclobutyl(2-hydroxyethyl)amino]ethyl-[6-(2-octyldecylamino)-6-oxohexyl]amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CNC(=O)CCCCCN(CCCCCC(=O)OC)CCN(CCO)C1CCC1 |
| InChI | InChI=1S/C39H77N3O4/c1-4-6-8-10-12-16-23-36(24-17-13-11-9-7-5-2)35-40-38(44)27-18-14-20-29-41(30-21-15-19-28-39(45)46-3)31-32-42(33-34-43)37-25-22-26-37/h36-37,43H,4-35H2,1-3H3,(H,40,44) |
| InChIKey | KOIHAQCPENYMMR-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.06 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|