C76H145N3O6 — CID 169317480
[6-[cyclooctyl-[2-[[6-(2-hexyldecylamino)-6-oxohexyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(3-hexylundecanoyloxymethyl)hexyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 169317480) has the molecular formula C76H145N3O6 and a molecular weight of 1197.01 g/mol. Its IUPAC name is [6-[cyclooctyl-[2-[[6-(2-hexyldecylamino)-6-oxohexyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(3-hexylundecanoyloxymethyl)hexyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [6-[cyclooctyl-[2-[[6-(2-hexyldecylamino)-6-oxohexyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(3-hexylundecanoyloxymethyl)hexyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 169317480 |
| Molecular Formula | C76H145N3O6 |
| Molecular Weight | 1197.01 g/mol |
| Exact Mass | 1196.11 |
| IUPAC Name | [6-[cyclooctyl-[2-[[6-(2-hexyldecylamino)-6-oxohexyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(3-hexylundecanoyloxymethyl)hexyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CCCCN(CCN(CCO)CCCCCC(=O)NCC(CCCCCC)CCCCCCCC)C1CCCCCCC1)COC(=O)CC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C76H145N3O6/c1-6-11-16-21-24-25-26-27-28-29-30-31-32-38-47-59-75(82)84-68-72(69-85-76(83)66-70(51-40-19-14-9-4)52-42-34-22-17-12-7-2)55-48-50-61-79(73-56-44-36-33-37-45-57-73)63-62-78(64-65-80)60-49-39-46-58-74(81)77-67-71(53-41-20-15-10-5)54-43-35-23-18-13-8-3/h24-25,27-28,70-73,80H,6-23,26,29-69H2,1-5H3,(H,77,81)/b25-24-,28-27- |
| InChIKey | XQVTWUMKGWSGPU-WGSVINMHSA-N |
| XLogP | 21.12 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 63 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1197.01 |
| LogP ≤ 5 | 21.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|