C48H89NO5 — CID 168858066
[6-[cyclobutyl(2-hydroxyethyl)amino]-2-(3-hexylundecanoyloxymethyl)hexyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 168858066) has the molecular formula C48H89NO5 and a molecular weight of 760.24 g/mol. Its IUPAC name is [6-[cyclobutyl(2-hydroxyethyl)amino]-2-(3-hexylundecanoyloxymethyl)hexyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [6-[cyclobutyl(2-hydroxyethyl)amino]-2-(3-hexylundecanoyloxymethyl)hexyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 168858066 |
| Molecular Formula | C48H89NO5 |
| Molecular Weight | 760.24 g/mol |
| Exact Mass | 759.67 |
| IUPAC Name | [6-[cyclobutyl(2-hydroxyethyl)amino]-2-(3-hexylundecanoyloxymethyl)hexyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CCCCN(CCO)C1CCC1)COC(=O)CC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C48H89NO5/c1-4-7-10-13-15-16-17-18-19-20-21-22-23-25-28-37-47(51)53-42-45(34-29-30-38-49(39-40-50)46-35-31-36-46)43-54-48(52)41-44(32-26-12-9-6-3)33-27-24-14-11-8-5-2/h15-16,18-19,44-46,50H,4-14,17,20-43H2,1-3H3/b16-15-,19-18- |
| InChIKey | OBGXKVHVWYOHHI-GJLVVWLQSA-N |
| XLogP | 13.25 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.24 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|