C56H110N2O5 — CID 169317366
2-hexyldecyl 6-[2-[cyclohexyl-[6-(2-octyldecoxy)-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate (PubChem CID 169317366) has the molecular formula C56H110N2O5 and a molecular weight of 891.50 g/mol. Its IUPAC name is 2-hexyldecyl 6-[2-[cyclohexyl-[6-(2-octyldecoxy)-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[2-[cyclohexyl-[6-(2-octyldecoxy)-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 169317366 |
| Molecular Formula | C56H110N2O5 |
| Molecular Weight | 891.50 g/mol |
| Exact Mass | 890.84 |
| IUPAC Name | 2-hexyldecyl 6-[2-[cyclohexyl-[6-(2-octyldecoxy)-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCO)CCN(CCCCCC(=O)OCC(CCCCCCCC)CCCCCCCC)C1CCCCC1 |
| InChI | InChI=1S/C56H110N2O5/c1-5-9-13-17-20-27-37-52(36-26-16-12-8-4)50-62-55(60)42-32-24-34-44-57(48-49-59)46-47-58(54-40-30-23-31-41-54)45-35-25-33-43-56(61)63-51-53(38-28-21-18-14-10-6-2)39-29-22-19-15-11-7-3/h52-54,59H,5-51H2,1-4H3 |
| InChIKey | QAVNRCGMMUCEEZ-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.50 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|