C55H108N2O5 — CID 169317424
2-hexyldecyl 6-[2-[cycloheptyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate (PubChem CID 169317424) has the molecular formula C55H108N2O5 and a molecular weight of 877.48 g/mol. Its IUPAC name is 2-hexyldecyl 6-[2-[cycloheptyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[2-[cycloheptyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate |
|---|---|
| PubChem CID | 169317424 |
| Molecular Formula | C55H108N2O5 |
| Molecular Weight | 877.48 g/mol |
| Exact Mass | 876.83 |
| IUPAC Name | 2-hexyldecyl 6-[2-[cycloheptyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]ethyl-(2-hydroxyethyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCO)CCN(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)C1CCCCCC1 |
| InChI | InChI=1S/C55H108N2O5/c1-5-9-13-17-19-27-37-51(35-25-15-11-7-3)49-61-54(59)41-31-23-33-43-56(47-48-58)45-46-57(53-39-29-21-22-30-40-53)44-34-24-32-42-55(60)62-50-52(36-26-16-12-8-4)38-28-20-18-14-10-6-2/h51-53,58H,5-50H2,1-4H3 |
| InChIKey | GXUZCSKAXWJBDZ-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.48 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|