C57H110N2O7 — CID 169317589
[6-[cyclooctyl-[2-[[6-(2-hexyldecoxy)-6-oxohexyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate (PubChem CID 169317589) has the molecular formula C57H110N2O7 and a molecular weight of 935.51 g/mol. Its IUPAC name is [6-[cyclooctyl-[2-[[6-(2-hexyldecoxy)-6-oxohexyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate.
| Compound Name | [6-[cyclooctyl-[2-[[6-(2-hexyldecoxy)-6-oxohexyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate |
|---|---|
| PubChem CID | 169317589 |
| Molecular Formula | C57H110N2O7 |
| Molecular Weight | 935.51 g/mol |
| Exact Mass | 934.83 |
| IUPAC Name | [6-[cyclooctyl-[2-[[6-(2-hexyldecoxy)-6-oxohexyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCO)CCN(CCCCC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)C1CCCCCCC1 |
| InChI | InChI=1S/C57H110N2O7/c1-5-9-13-17-21-26-36-52(35-25-16-12-8-4)49-64-55(61)42-31-24-33-43-58(47-48-60)45-46-59(54-38-27-22-18-23-28-39-54)44-34-32-37-53(50-65-56(62)40-29-19-14-10-6-2)51-66-57(63)41-30-20-15-11-7-3/h52-54,60H,5-51H2,1-4H3 |
| InChIKey | FEDYNHYAIINFLU-UHFFFAOYSA-N |
| XLogP | 14.73 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.51 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|