C56H109N3O6 — CID 170367621
[6-[cyclooctyl-[2-[[5-(2-hexyldecylamino)-5-oxopentyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate (PubChem CID 170367621) has the molecular formula C56H109N3O6 and a molecular weight of 920.50 g/mol. Its IUPAC name is [6-[cyclooctyl-[2-[[5-(2-hexyldecylamino)-5-oxopentyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate.
| Compound Name | [6-[cyclooctyl-[2-[[5-(2-hexyldecylamino)-5-oxopentyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate |
|---|---|
| PubChem CID | 170367621 |
| Molecular Formula | C56H109N3O6 |
| Molecular Weight | 920.50 g/mol |
| Exact Mass | 919.83 |
| IUPAC Name | [6-[cyclooctyl-[2-[[5-(2-hexyldecylamino)-5-oxopentyl]-(2-hydroxyethyl)amino]ethyl]amino]-2-(octanoyloxymethyl)hexyl] octanoate |
| SMILES | CCCCCCCCC(CCCCCC)CNC(=O)CCCCN(CCO)CCN(CCCCC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)C1CCCCCCC1 |
| InChI | InChI=1S/C56H109N3O6/c1-5-9-13-17-21-25-35-51(34-24-16-12-8-4)48-57-54(61)39-31-32-42-58(46-47-60)44-45-59(53-37-26-22-18-23-27-38-53)43-33-30-36-52(49-64-55(62)40-28-19-14-10-6-2)50-65-56(63)41-29-20-15-11-7-3/h51-53,60H,5-50H2,1-4H3,(H,57,61) |
| InChIKey | LISXCKGUBAJNJM-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.50 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|