C55H110N4O3 — CID 164773663
6-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]-N-(2-hexyldecyl)hexanamide (PubChem CID 164773663) has the molecular formula C55H110N4O3 and a molecular weight of 875.51 g/mol. Its IUPAC name is 6-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]-N-(2-hexyldecyl)hexanamide.
| Compound Name | 6-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]-N-(2-hexyldecyl)hexanamide |
|---|---|
| PubChem CID | 164773663 |
| Molecular Formula | C55H110N4O3 |
| Molecular Weight | 875.51 g/mol |
| Exact Mass | 874.86 |
| IUPAC Name | 6-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]-N-(2-hexyldecyl)hexanamide |
| SMILES | CCCCCCCCC(CCCCCC)CNC(=O)CCCCCN(CCCCCC(=O)NCC(CCCCCC)CCCCCCCC)CCN(CCO)C1CCCCCC1 |
| InChI | InChI=1S/C55H110N4O3/c1-5-9-13-17-19-27-37-51(35-25-15-11-7-3)49-56-54(61)41-31-23-33-43-58(45-46-59(47-48-60)53-39-29-21-22-30-40-53)44-34-24-32-42-55(62)57-50-52(36-26-16-12-8-4)38-28-20-18-14-10-6-2/h51-53,60H,5-50H2,1-4H3,(H,56,61)(H,57,62) |
| InChIKey | ALLRHFLPPKVAQL-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.51 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|