C52H108N6O3 — CID 167069469
1-[4-[2-[cyclohexyl(2-hydroxyethyl)amino]ethyl-[4-[[(2-hexyldecylamino)-hydroxymethyl]amino]butyl]amino]butyl]-3-(2-hexyldecyl)urea (PubChem CID 167069469) has the molecular formula C52H108N6O3 and a molecular weight of 865.47 g/mol. Its IUPAC name is 1-[4-[2-[cyclohexyl(2-hydroxyethyl)amino]ethyl-[4-[[(2-hexyldecylamino)-hydroxymethyl]amino]butyl]amino]butyl]-3-(2-hexyldecyl)urea.
| Compound Name | 1-[4-[2-[cyclohexyl(2-hydroxyethyl)amino]ethyl-[4-[[(2-hexyldecylamino)-hydroxymethyl]amino]butyl]amino]butyl]-3-(2-hexyldecyl)urea |
|---|---|
| PubChem CID | 167069469 |
| Molecular Formula | C52H108N6O3 |
| Molecular Weight | 865.47 g/mol |
| Exact Mass | 864.85 |
| IUPAC Name | 1-[4-[2-[cyclohexyl(2-hydroxyethyl)amino]ethyl-[4-[[(2-hexyldecylamino)-hydroxymethyl]amino]butyl]amino]butyl]-3-(2-hexyldecyl)urea |
| SMILES | CCCCCCCCC(CCCCCC)CNC(=O)NCCCCN(CCCCNC(O)NCC(CCCCCC)CCCCCCCC)CCN(CCO)C1CCCCC1 |
| InChI | InChI=1S/C52H108N6O3/c1-5-9-13-17-19-24-34-48(32-22-15-11-7-3)46-55-51(60)53-38-28-30-40-57(42-43-58(44-45-59)50-36-26-21-27-37-50)41-31-29-39-54-52(61)56-47-49(33-23-16-12-8-4)35-25-20-18-14-10-6-2/h48-51,53,55,59-60H,5-47H2,1-4H3,(H2,54,56,61) |
| InChIKey | WIPSQTFGRRBHTK-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.47 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|