C52H104N4O2 — CID 170198532
6-[2-[cyclobutyl(ethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]-N-(2-hexyldecyl)hexanamide (PubChem CID 170198532) has the molecular formula C52H104N4O2 and a molecular weight of 817.43 g/mol. Its IUPAC name is 6-[2-[cyclobutyl(ethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]-N-(2-hexyldecyl)hexanamide.
| Compound Name | 6-[2-[cyclobutyl(ethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]-N-(2-hexyldecyl)hexanamide |
|---|---|
| PubChem CID | 170198532 |
| Molecular Formula | C52H104N4O2 |
| Molecular Weight | 817.43 g/mol |
| Exact Mass | 816.82 |
| IUPAC Name | 6-[2-[cyclobutyl(ethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]-N-(2-hexyldecyl)hexanamide |
| SMILES | CCCCCCCCC(CCCCCC)CNC(=O)CCCCCN(CCCCCC(=O)NCC(CCCCCC)CCCCCCCC)CCN(CC)C1CCC1 |
| InChI | InChI=1S/C52H104N4O2/c1-6-11-15-19-21-27-36-48(34-25-17-13-8-3)46-53-51(57)40-29-23-31-42-55(44-45-56(10-5)50-38-33-39-50)43-32-24-30-41-52(58)54-47-49(35-26-18-14-9-4)37-28-22-20-16-12-7-2/h48-50H,6-47H2,1-5H3,(H,53,57)(H,54,58) |
| InChIKey | YLSLCAYFOSAMRN-UHFFFAOYSA-N |
| XLogP | 14.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.43 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|