C53H105N3O3 — CID 170198617
2-hexyldecyl 6-[2-[cyclopentyl(ethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]hexanoate (PubChem CID 170198617) has the molecular formula C53H105N3O3 and a molecular weight of 832.44 g/mol. Its IUPAC name is 2-hexyldecyl 6-[2-[cyclopentyl(ethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[2-[cyclopentyl(ethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]hexanoate |
|---|---|
| PubChem CID | 170198617 |
| Molecular Formula | C53H105N3O3 |
| Molecular Weight | 832.44 g/mol |
| Exact Mass | 831.82 |
| IUPAC Name | 2-hexyldecyl 6-[2-[cyclopentyl(ethyl)amino]ethyl-[6-(2-hexyldecylamino)-6-oxohexyl]amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)CNC(=O)CCCCCN(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)CCN(CC)C1CCCC1 |
| InChI | InChI=1S/C53H105N3O3/c1-6-11-15-19-21-27-36-49(35-25-17-13-8-3)47-54-52(57)41-29-23-33-43-55(45-46-56(10-5)51-39-31-32-40-51)44-34-24-30-42-53(58)59-48-50(37-26-18-14-9-4)38-28-22-20-16-12-7-2/h49-51H,6-48H2,1-5H3,(H,54,57) |
| InChIKey | VIZOOGFVRVNNPK-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.44 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|