C58H115N3O4 — CID 170609404
2-hexyldecyl 7-[2-[cyclobutyl-[4-(dimethylamino)butyl]amino]ethyl-[7-(2-hexyldecoxy)-7-oxoheptyl]amino]heptanoate (PubChem CID 170609404) has the molecular formula C58H115N3O4 and a molecular weight of 918.57 g/mol. Its IUPAC name is 2-hexyldecyl 7-[2-[cyclobutyl-[4-(dimethylamino)butyl]amino]ethyl-[7-(2-hexyldecoxy)-7-oxoheptyl]amino]heptanoate.
| Compound Name | 2-hexyldecyl 7-[2-[cyclobutyl-[4-(dimethylamino)butyl]amino]ethyl-[7-(2-hexyldecoxy)-7-oxoheptyl]amino]heptanoate |
|---|---|
| PubChem CID | 170609404 |
| Molecular Formula | C58H115N3O4 |
| Molecular Weight | 918.57 g/mol |
| Exact Mass | 917.89 |
| IUPAC Name | 2-hexyldecyl 7-[2-[cyclobutyl-[4-(dimethylamino)butyl]amino]ethyl-[7-(2-hexyldecoxy)-7-oxoheptyl]amino]heptanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCCN(CCCCCCC(=O)OCC(CCCCCC)CCCCCCCC)CCN(CCCCN(C)C)C1CCC1 |
| InChI | InChI=1S/C58H115N3O4/c1-7-11-15-19-21-29-40-54(38-27-17-13-9-3)52-64-57(62)44-31-23-25-33-47-60(50-51-61(56-42-37-43-56)49-36-35-46-59(5)6)48-34-26-24-32-45-58(63)65-53-55(39-28-18-14-10-4)41-30-22-20-16-12-8-2/h54-56H,7-53H2,1-6H3 |
| InChIKey | HDBOCVBAEKZZRH-UHFFFAOYSA-N |
| XLogP | 16.15 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.57 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|