C57H112N2O6 — CID 164773544
2-octyldecyl 6-[2-[2-hydroxyethyl(oxan-3-yl)amino]ethyl-[6-(2-octyldecoxy)-6-oxohexyl]amino]hexanoate (PubChem CID 164773544) has the molecular formula C57H112N2O6 and a molecular weight of 921.53 g/mol. Its IUPAC name is 2-octyldecyl 6-[2-[2-hydroxyethyl(oxan-3-yl)amino]ethyl-[6-(2-octyldecoxy)-6-oxohexyl]amino]hexanoate.
| Compound Name | 2-octyldecyl 6-[2-[2-hydroxyethyl(oxan-3-yl)amino]ethyl-[6-(2-octyldecoxy)-6-oxohexyl]amino]hexanoate |
|---|---|
| PubChem CID | 164773544 |
| Molecular Formula | C57H112N2O6 |
| Molecular Weight | 921.53 g/mol |
| Exact Mass | 920.85 |
| IUPAC Name | 2-octyldecyl 6-[2-[2-hydroxyethyl(oxan-3-yl)amino]ethyl-[6-(2-octyldecoxy)-6-oxohexyl]amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)COC(=O)CCCCCN(CCCCCC(=O)OCC(CCCCCCCC)CCCCCCCC)CCN(CCO)C1CCCOC1 |
| InChI | InChI=1S/C57H112N2O6/c1-5-9-13-17-21-27-36-53(37-28-22-18-14-10-6-2)50-64-56(61)41-31-25-33-43-58(45-46-59(47-48-60)55-40-35-49-63-52-55)44-34-26-32-42-57(62)65-51-54(38-29-23-19-15-11-7-3)39-30-24-20-16-12-8-4/h53-55,60H,5-52H2,1-4H3 |
| InChIKey | FELVWWYUNCJSMP-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.53 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|