C53H102N2O6 — CID 164773540
2-hexyldecyl 6-[3-[cyclobutyl(2-hydroxyethyl)amino]propanoyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoate (PubChem CID 164773540) has the molecular formula C53H102N2O6 and a molecular weight of 863.41 g/mol. Its IUPAC name is 2-hexyldecyl 6-[3-[cyclobutyl(2-hydroxyethyl)amino]propanoyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[3-[cyclobutyl(2-hydroxyethyl)amino]propanoyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoate |
|---|---|
| PubChem CID | 164773540 |
| Molecular Formula | C53H102N2O6 |
| Molecular Weight | 863.41 g/mol |
| Exact Mass | 862.77 |
| IUPAC Name | 2-hexyldecyl 6-[3-[cyclobutyl(2-hydroxyethyl)amino]propanoyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)C(=O)CCN(CCO)C1CCC1 |
| InChI | InChI=1S/C53H102N2O6/c1-5-9-13-17-19-25-34-48(32-23-15-11-7-3)46-60-52(58)38-27-21-29-41-55(51(57)40-43-54(44-45-56)50-36-31-37-50)42-30-22-28-39-53(59)61-47-49(33-24-16-12-8-4)35-26-20-18-14-10-6-2/h48-50,56H,5-47H2,1-4H3 |
| InChIKey | PHNPZAPIOFFMRY-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.41 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|