C51H99NO5 — CID 168857952
[6-[cyclobutyl(2-hydroxyethyl)amino]-2-(3-octylundecanoyloxymethyl)hexyl] 3-octylundecanoate (PubChem CID 168857952) has the molecular formula C51H99NO5 and a molecular weight of 806.35 g/mol. Its IUPAC name is [6-[cyclobutyl(2-hydroxyethyl)amino]-2-(3-octylundecanoyloxymethyl)hexyl] 3-octylundecanoate.
| Compound Name | [6-[cyclobutyl(2-hydroxyethyl)amino]-2-(3-octylundecanoyloxymethyl)hexyl] 3-octylundecanoate |
|---|---|
| PubChem CID | 168857952 |
| Molecular Formula | C51H99NO5 |
| Molecular Weight | 806.35 g/mol |
| Exact Mass | 805.75 |
| IUPAC Name | [6-[cyclobutyl(2-hydroxyethyl)amino]-2-(3-octylundecanoyloxymethyl)hexyl] 3-octylundecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CC(=O)OCC(CCCCN(CCO)C1CCC1)COC(=O)CC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C51H99NO5/c1-5-9-13-17-21-25-32-46(33-26-22-18-14-10-6-2)42-50(54)56-44-48(36-29-30-39-52(40-41-53)49-37-31-38-49)45-57-51(55)43-47(34-27-23-19-15-11-7-3)35-28-24-20-16-12-8-4/h46-49,53H,5-45H2,1-4H3 |
| InChIKey | LTIQJZGNEPUZDU-UHFFFAOYSA-N |
| XLogP | 14.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.35 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|