C56H108N2O5 — CID 168857923
[6-[cyclobutyl-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl]amino]-2-(3-hexylundecanoyloxymethyl)hexyl] 3-hexylundecanoate (PubChem CID 168857923) has the molecular formula C56H108N2O5 and a molecular weight of 889.49 g/mol. Its IUPAC name is [6-[cyclobutyl-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl]amino]-2-(3-hexylundecanoyloxymethyl)hexyl] 3-hexylundecanoate.
| Compound Name | [6-[cyclobutyl-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl]amino]-2-(3-hexylundecanoyloxymethyl)hexyl] 3-hexylundecanoate |
|---|---|
| PubChem CID | 168857923 |
| Molecular Formula | C56H108N2O5 |
| Molecular Weight | 889.49 g/mol |
| Exact Mass | 888.83 |
| IUPAC Name | [6-[cyclobutyl-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl]amino]-2-(3-hexylundecanoyloxymethyl)hexyl] 3-hexylundecanoate |
| SMILES | CCCCCCCCC(CCCCCC)CC(=O)OCC(CCCCN(CCN(CCO)C1CCCCCC1)C1CCC1)COC(=O)CC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C56H108N2O5/c1-5-9-13-17-19-25-34-50(32-23-15-11-7-3)46-55(60)62-48-52(49-63-56(61)47-51(33-24-16-12-8-4)35-26-20-18-14-10-6-2)36-29-30-41-57(54-39-31-40-54)42-43-58(44-45-59)53-37-27-21-22-28-38-53/h50-54,59H,5-49H2,1-4H3 |
| InChIKey | LIYWZFWRYNEVSV-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.49 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|