C54H107N3O4 — CID 169317775
6-[2-[cyclobutyl-[5-(3-octylundecanoylamino)pentyl]amino]ethyl-(2-hydroxyethyl)amino]hexyl 2-hexyldecanoate (PubChem CID 169317775) has the molecular formula C54H107N3O4 and a molecular weight of 862.47 g/mol. Its IUPAC name is 6-[2-[cyclobutyl-[5-(3-octylundecanoylamino)pentyl]amino]ethyl-(2-hydroxyethyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[2-[cyclobutyl-[5-(3-octylundecanoylamino)pentyl]amino]ethyl-(2-hydroxyethyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 169317775 |
| Molecular Formula | C54H107N3O4 |
| Molecular Weight | 862.47 g/mol |
| Exact Mass | 861.83 |
| IUPAC Name | 6-[2-[cyclobutyl-[5-(3-octylundecanoylamino)pentyl]amino]ethyl-(2-hydroxyethyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CC(=O)NCCCCCN(CCN(CCO)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)C1CCC1 |
| InChI | InChI=1S/C54H107N3O4/c1-5-9-13-17-20-26-35-50(36-27-21-18-14-10-6-2)49-53(59)55-41-30-25-32-43-57(52-39-34-40-52)45-44-56(46-47-58)42-31-23-24-33-48-61-54(60)51(37-28-16-12-8-4)38-29-22-19-15-11-7-3/h50-52,58H,5-49H2,1-4H3,(H,55,59) |
| InChIKey | LDEYPSIASVTZJM-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.47 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|