C56H109N3O4 — CID 169317571
5-[2-[cycloheptyl-[5-(3-hexylundecanoylamino)pentyl]amino]ethyl-(2-hydroxyethyl)amino]pentyl (Z)-octadec-9-enoate (PubChem CID 169317571) has the molecular formula C56H109N3O4 and a molecular weight of 888.50 g/mol. Its IUPAC name is 5-[2-[cycloheptyl-[5-(3-hexylundecanoylamino)pentyl]amino]ethyl-(2-hydroxyethyl)amino]pentyl (Z)-octadec-9-enoate.
| Compound Name | 5-[2-[cycloheptyl-[5-(3-hexylundecanoylamino)pentyl]amino]ethyl-(2-hydroxyethyl)amino]pentyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 169317571 |
| Molecular Formula | C56H109N3O4 |
| Molecular Weight | 888.50 g/mol |
| Exact Mass | 887.84 |
| IUPAC Name | 5-[2-[cycloheptyl-[5-(3-hexylundecanoylamino)pentyl]amino]ethyl-(2-hydroxyethyl)amino]pentyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCCCN(CCO)CCN(CCCCCNC(=O)CC(CCCCCC)CCCCCCCC)C1CCCCCC1 |
| InChI | InChI=1S/C56H109N3O4/c1-4-7-10-13-15-16-17-18-19-20-21-22-23-25-34-43-56(62)63-51-38-29-36-45-58(49-50-60)47-48-59(54-41-32-26-27-33-42-54)46-37-28-35-44-57-55(61)52-53(39-30-12-9-6-3)40-31-24-14-11-8-5-2/h18-19,53-54,60H,4-17,20-52H2,1-3H3,(H,57,61)/b19-18- |
| InChIKey | JSZVJZMCVZFGPO-HNENSFHCSA-N |
| XLogP | 15.07 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.50 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|