C52H93NO7S — CID 169317572
[6-[cyclohexyl(2-methylsulfonyloxyethyl)amino]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl]hexyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 169317572) has the molecular formula C52H93NO7S and a molecular weight of 876.38 g/mol. Its IUPAC name is [6-[cyclohexyl(2-methylsulfonyloxyethyl)amino]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl]hexyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [6-[cyclohexyl(2-methylsulfonyloxyethyl)amino]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl]hexyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 169317572 |
| Molecular Formula | C52H93NO7S |
| Molecular Weight | 876.38 g/mol |
| Exact Mass | 875.67 |
| IUPAC Name | [6-[cyclohexyl(2-methylsulfonyloxyethyl)amino]-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]oxymethyl]hexyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(CCCCN(CCOS(C)(=O)=O)C1CCCCC1)COC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C52H93NO7S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-35-42-51(54)58-47-49(39-37-38-44-53(45-46-60-61(3,56)57)50-40-33-32-34-41-50)48-59-52(55)43-36-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,49-50H,4-11,16-17,22-48H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | FXALEBFQOZTVHB-QYCRHRGJSA-N |
| XLogP | 14.10 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.38 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|