C48H95NO7S — CID 176870498
2-hexyldecyl 6-[[6-(2-hexyldecoxy)-6-oxohexyl]-(3-methylsulfonyloxypropyl)amino]hexanoate (PubChem CID 176870498) has the molecular formula C48H95NO7S and a molecular weight of 830.35 g/mol. Its IUPAC name is 2-hexyldecyl 6-[[6-(2-hexyldecoxy)-6-oxohexyl]-(3-methylsulfonyloxypropyl)amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[[6-(2-hexyldecoxy)-6-oxohexyl]-(3-methylsulfonyloxypropyl)amino]hexanoate |
|---|---|
| PubChem CID | 176870498 |
| Molecular Formula | C48H95NO7S |
| Molecular Weight | 830.35 g/mol |
| Exact Mass | 829.68 |
| IUPAC Name | 2-hexyldecyl 6-[[6-(2-hexyldecoxy)-6-oxohexyl]-(3-methylsulfonyloxypropyl)amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)CCCOS(C)(=O)=O |
| InChI | InChI=1S/C48H95NO7S/c1-6-10-14-18-20-26-35-45(33-24-16-12-8-3)43-54-47(50)37-28-22-30-39-49(41-32-42-56-57(5,52)53)40-31-23-29-38-48(51)55-44-46(34-25-17-13-9-4)36-27-21-19-15-11-7-2/h45-46H,6-44H2,1-5H3 |
| InChIKey | XQUSYGXFWQPRET-UHFFFAOYSA-N |
| XLogP | 13.54 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.35 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|