C53H105NO7S — CID 135358355
2-hexyldecyl 8-[[8-(2-hexyldecoxy)-8-oxooctyl]-(4-methylsulfonyloxybutyl)amino]octanoate (PubChem CID 135358355) has the molecular formula C53H105NO7S and a molecular weight of 900.49 g/mol. Its IUPAC name is 2-hexyldecyl 8-[[8-(2-hexyldecoxy)-8-oxooctyl]-(4-methylsulfonyloxybutyl)amino]octanoate.
| Compound Name | 2-hexyldecyl 8-[[8-(2-hexyldecoxy)-8-oxooctyl]-(4-methylsulfonyloxybutyl)amino]octanoate |
|---|---|
| PubChem CID | 135358355 |
| Molecular Formula | C53H105NO7S |
| Molecular Weight | 900.49 g/mol |
| Exact Mass | 899.76 |
| IUPAC Name | 2-hexyldecyl 8-[[8-(2-hexyldecoxy)-8-oxooctyl]-(4-methylsulfonyloxybutyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCCCN(CCCCCCCC(=O)OCC(CCCCCC)CCCCCCCC)CCCCOS(C)(=O)=O |
| InChI | InChI=1S/C53H105NO7S/c1-6-10-14-18-22-30-40-50(38-28-16-12-8-3)48-59-52(55)42-32-24-20-26-34-44-54(46-36-37-47-61-62(5,57)58)45-35-27-21-25-33-43-53(56)60-49-51(39-29-17-13-9-4)41-31-23-19-15-11-7-2/h50-51H,6-49H2,1-5H3 |
| InChIKey | FDOUWDBHRUIQHK-UHFFFAOYSA-N |
| XLogP | 15.49 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.49 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|