C53H108N2O4Si — CID 170743396
6-[6-[dimethyl(1-octoxyoctoxy)silyl]hexyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]hexyl 2-hexyldecanoate (PubChem CID 170743396) has the molecular formula C53H108N2O4Si and a molecular weight of 865.54 g/mol. Its IUPAC name is 6-[6-[dimethyl(1-octoxyoctoxy)silyl]hexyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[6-[dimethyl(1-octoxyoctoxy)silyl]hexyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 170743396 |
| Molecular Formula | C53H108N2O4Si |
| Molecular Weight | 865.54 g/mol |
| Exact Mass | 864.81 |
| IUPAC Name | 6-[6-[dimethyl(1-octoxyoctoxy)silyl]hexyl-[2-(1-methylpyrrolidin-2-yl)ethyl]amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCOC(CCCCCCC)O[Si](C)(C)CCCCCCN(CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCC1CCCN1C |
| InChI | InChI=1S/C53H108N2O4Si/c1-8-12-16-20-23-30-39-50(38-29-19-15-11-4)53(56)58-48-35-27-24-32-44-55(46-42-51-40-37-43-54(51)5)45-33-25-28-36-49-60(6,7)59-52(41-31-22-18-14-10-3)57-47-34-26-21-17-13-9-2/h50-52H,8-49H2,1-7H3 |
| InChIKey | SQOSOGLBDLFZOX-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.54 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|