C45H89N3O4 — CID 164814116
3-[3-(2-hexyldecanoyloxy)propyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]propyl 2-hexyldecanoate (PubChem CID 164814116) has the molecular formula C45H89N3O4 and a molecular weight of 736.22 g/mol. Its IUPAC name is 3-[3-(2-hexyldecanoyloxy)propyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]propyl 2-hexyldecanoate.
| Compound Name | 3-[3-(2-hexyldecanoyloxy)propyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]propyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 164814116 |
| Molecular Formula | C45H89N3O4 |
| Molecular Weight | 736.22 g/mol |
| Exact Mass | 735.69 |
| IUPAC Name | 3-[3-(2-hexyldecanoyloxy)propyl-[2-(4-methylpiperazin-1-yl)ethyl]amino]propyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCN(CCCOC(=O)C(CCCCCC)CCCCCCCC)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C45H89N3O4/c1-6-10-14-18-20-24-30-42(28-22-16-12-8-3)44(49)51-40-26-32-47(38-39-48-36-34-46(5)35-37-48)33-27-41-52-45(50)43(29-23-17-13-9-4)31-25-21-19-15-11-7-2/h42-43H,6-41H2,1-5H3 |
| InChIKey | BADHKECRANNGMC-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.22 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|