C44H87N3O4 — CID 171658698
nonyl 2-methyl-8-[(7-methyl-8-nonoxy-8-oxooctyl)-[3-(4-methylpiperazin-1-yl)propyl]amino]octanoate (PubChem CID 171658698) has the molecular formula C44H87N3O4 and a molecular weight of 722.20 g/mol. Its IUPAC name is nonyl 2-methyl-8-[(7-methyl-8-nonoxy-8-oxooctyl)-[3-(4-methylpiperazin-1-yl)propyl]amino]octanoate.
| Compound Name | nonyl 2-methyl-8-[(7-methyl-8-nonoxy-8-oxooctyl)-[3-(4-methylpiperazin-1-yl)propyl]amino]octanoate |
|---|---|
| PubChem CID | 171658698 |
| Molecular Formula | C44H87N3O4 |
| Molecular Weight | 722.20 g/mol |
| Exact Mass | 721.67 |
| IUPAC Name | nonyl 2-methyl-8-[(7-methyl-8-nonoxy-8-oxooctyl)-[3-(4-methylpiperazin-1-yl)propyl]amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)C(C)CCCCCCN(CCCCCCC(C)C(=O)OCCCCCCCCC)CCCN1CCN(C)CC1 |
| InChI | InChI=1S/C44H87N3O4/c1-6-8-10-12-14-20-26-39-50-43(48)41(3)29-22-16-18-24-31-46(33-28-34-47-37-35-45(5)36-38-47)32-25-19-17-23-30-42(4)44(49)51-40-27-21-15-13-11-9-7-2/h41-42H,6-40H2,1-5H3 |
| InChIKey | RNJIOYBCLLSACW-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.20 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|