C50H95N3O12 — CID 171658884
2-[3-[[3-[2-(4,4-dihexoxybutanoyloxy)ethoxy]-3-oxopropyl]-[3-(4-methylpiperazin-1-yl)propyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate (PubChem CID 171658884) has the molecular formula C50H95N3O12 and a molecular weight of 930.32 g/mol. Its IUPAC name is 2-[3-[[3-[2-(4,4-dihexoxybutanoyloxy)ethoxy]-3-oxopropyl]-[3-(4-methylpiperazin-1-yl)propyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate.
| Compound Name | 2-[3-[[3-[2-(4,4-dihexoxybutanoyloxy)ethoxy]-3-oxopropyl]-[3-(4-methylpiperazin-1-yl)propyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate |
|---|---|
| PubChem CID | 171658884 |
| Molecular Formula | C50H95N3O12 |
| Molecular Weight | 930.32 g/mol |
| Exact Mass | 929.69 |
| IUPAC Name | 2-[3-[[3-[2-(4,4-dihexoxybutanoyloxy)ethoxy]-3-oxopropyl]-[3-(4-methylpiperazin-1-yl)propyl]amino]propanoyloxy]ethyl 4,4-dihexoxybutanoate |
| SMILES | CCCCCCOC(CCC(=O)OCCOC(=O)CCN(CCCN1CCN(C)CC1)CCC(=O)OCCOC(=O)CCC(OCCCCCC)OCCCCCC)OCCCCCC |
| InChI | InChI=1S/C50H95N3O12/c1-6-10-14-18-37-62-49(63-38-19-15-11-7-2)25-23-45(54)58-41-43-60-47(56)27-31-52(29-22-30-53-35-33-51(5)34-36-53)32-28-48(57)61-44-42-59-46(55)24-26-50(64-39-20-16-12-8-3)65-40-21-17-13-9-4/h49-50H,6-44H2,1-5H3 |
| InChIKey | JCEKGLNYVZBVTE-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 151.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.32 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|