C42H83N3O4 — CID 167418965
pentyl 8-[2-(4-methylpiperazin-1-yl)ethyl-(8-oxo-8-tetradecan-7-yloxyoctyl)amino]octanoate (PubChem CID 167418965) has the molecular formula C42H83N3O4 and a molecular weight of 694.14 g/mol. Its IUPAC name is pentyl 8-[2-(4-methylpiperazin-1-yl)ethyl-(8-oxo-8-tetradecan-7-yloxyoctyl)amino]octanoate.
| Compound Name | pentyl 8-[2-(4-methylpiperazin-1-yl)ethyl-(8-oxo-8-tetradecan-7-yloxyoctyl)amino]octanoate |
|---|---|
| PubChem CID | 167418965 |
| Molecular Formula | C42H83N3O4 |
| Molecular Weight | 694.14 g/mol |
| Exact Mass | 693.64 |
| IUPAC Name | pentyl 8-[2-(4-methylpiperazin-1-yl)ethyl-(8-oxo-8-tetradecan-7-yloxyoctyl)amino]octanoate |
| SMILES | CCCCCCCC(CCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OCCCCC)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C42H83N3O4/c1-5-8-11-15-21-28-40(27-20-12-9-6-2)49-42(47)30-23-17-14-19-25-32-44(37-38-45-35-33-43(4)34-36-45)31-24-18-13-16-22-29-41(46)48-39-26-10-7-3/h40H,5-39H2,1-4H3 |
| InChIKey | ZJZNUHCWFVAEMO-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.14 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|