C42H84N2O4 — CID 171836854
pentyl 10-[3-aminopropyl-(5-nonadecan-10-yloxy-5-oxopentyl)amino]decanoate (PubChem CID 171836854) has the molecular formula C42H84N2O4 and a molecular weight of 681.14 g/mol. Its IUPAC name is pentyl 10-[3-aminopropyl-(5-nonadecan-10-yloxy-5-oxopentyl)amino]decanoate.
| Compound Name | pentyl 10-[3-aminopropyl-(5-nonadecan-10-yloxy-5-oxopentyl)amino]decanoate |
|---|---|
| PubChem CID | 171836854 |
| Molecular Formula | C42H84N2O4 |
| Molecular Weight | 681.14 g/mol |
| Exact Mass | 680.64 |
| IUPAC Name | pentyl 10-[3-aminopropyl-(5-nonadecan-10-yloxy-5-oxopentyl)amino]decanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCC)OC(=O)CCCCN(CCCN)CCCCCCCCCC(=O)OCCCCC |
| InChI | InChI=1S/C42H84N2O4/c1-4-7-10-12-15-19-23-31-40(32-24-20-16-13-11-8-5-2)48-42(46)34-26-28-37-44(38-30-35-43)36-27-22-18-14-17-21-25-33-41(45)47-39-29-9-6-3/h40H,4-39,43H2,1-3H3 |
| InChIKey | FHANHSUNHKNSRH-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.14 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|