C47H96N2O4 — CID 160644641
methane;nonyl 8-[4-aminobutyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 160644641) has the molecular formula C47H96N2O4 and a molecular weight of 753.29 g/mol. Its IUPAC name is methane;nonyl 8-[4-aminobutyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | methane;nonyl 8-[4-aminobutyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 160644641 |
| Molecular Formula | C47H96N2O4 |
| Molecular Weight | 753.29 g/mol |
| Exact Mass | 752.74 |
| IUPAC Name | methane;nonyl 8-[4-aminobutyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | C.CCCCCCCCCOC(=O)CCCCCCCN(CCCCN)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C46H92N2O4.CH4/c1-4-7-10-13-16-25-34-43-51-45(49)37-28-21-17-23-31-40-48(42-33-30-39-47)41-32-24-18-22-29-38-46(50)52-44(35-26-19-14-11-8-5-2)36-27-20-15-12-9-6-3;/h44H,4-43,47H2,1-3H3;1H4 |
| InChIKey | RJPYCIGFHYVRGS-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.29 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|