C66H131NO9 — CID 167523726
7-[7-(4,4-didecoxybutanoyloxy)heptyl-(4-hydroxybutyl)amino]heptyl 4,4-didecoxybutanoate (PubChem CID 167523726) has the molecular formula C66H131NO9 and a molecular weight of 1082.77 g/mol. Its IUPAC name is 7-[7-(4,4-didecoxybutanoyloxy)heptyl-(4-hydroxybutyl)amino]heptyl 4,4-didecoxybutanoate.
| Compound Name | 7-[7-(4,4-didecoxybutanoyloxy)heptyl-(4-hydroxybutyl)amino]heptyl 4,4-didecoxybutanoate |
|---|---|
| PubChem CID | 167523726 |
| Molecular Formula | C66H131NO9 |
| Molecular Weight | 1082.77 g/mol |
| Exact Mass | 1081.98 |
| IUPAC Name | 7-[7-(4,4-didecoxybutanoyloxy)heptyl-(4-hydroxybutyl)amino]heptyl 4,4-didecoxybutanoate |
| SMILES | CCCCCCCCCCOC(CCC(=O)OCCCCCCCN(CCCCO)CCCCCCCOC(=O)CCC(OCCCCCCCCCC)OCCCCCCCCCC)OCCCCCCCCCC |
| InChI | InChI=1S/C66H131NO9/c1-5-9-13-17-21-25-33-45-59-73-65(74-60-46-34-26-22-18-14-10-6-2)51-49-63(69)71-57-43-37-29-31-39-53-67(55-41-42-56-68)54-40-32-30-38-44-58-72-64(70)50-52-66(75-61-47-35-27-23-19-15-11-7-3)76-62-48-36-28-24-20-16-12-8-4/h65-66,68H,5-62H2,1-4H3 |
| InChIKey | SFBHILSGTBSCLG-UHFFFAOYSA-N |
| XLogP | 18.89 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.77 |
| LogP ≤ 5 | 18.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|