C46H91NO7 — CID 164552688
nonyl 8-[6-(4,4-dioctoxybutanoyloxy)hexyl-(3-hydroxypropyl)amino]octanoate (PubChem CID 164552688) has the molecular formula C46H91NO7 and a molecular weight of 770.23 g/mol. Its IUPAC name is nonyl 8-[6-(4,4-dioctoxybutanoyloxy)hexyl-(3-hydroxypropyl)amino]octanoate.
| Compound Name | nonyl 8-[6-(4,4-dioctoxybutanoyloxy)hexyl-(3-hydroxypropyl)amino]octanoate |
|---|---|
| PubChem CID | 164552688 |
| Molecular Formula | C46H91NO7 |
| Molecular Weight | 770.23 g/mol |
| Exact Mass | 769.68 |
| IUPAC Name | nonyl 8-[6-(4,4-dioctoxybutanoyloxy)hexyl-(3-hydroxypropyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCO)CCCCCCOC(=O)CCC(OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C46H91NO7/c1-4-7-10-13-16-23-28-40-51-44(49)33-25-18-17-19-26-36-47(38-32-39-48)37-27-20-24-29-41-52-45(50)34-35-46(53-42-30-21-14-11-8-5-2)54-43-31-22-15-12-9-6-3/h46,48H,4-43H2,1-3H3 |
| InChIKey | RYKILYWGQDWYJI-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.23 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|