C74H138N2O11 — CID 168955504
nonyl 8-[2-[bis[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl]amino]ethyl-(3-hydroxypropyl)amino]octanoate (PubChem CID 168955504) has the molecular formula C74H138N2O11 and a molecular weight of 1231.92 g/mol. Its IUPAC name is nonyl 8-[2-[bis[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl]amino]ethyl-(3-hydroxypropyl)amino]octanoate.
| Compound Name | nonyl 8-[2-[bis[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl]amino]ethyl-(3-hydroxypropyl)amino]octanoate |
|---|---|
| PubChem CID | 168955504 |
| Molecular Formula | C74H138N2O11 |
| Molecular Weight | 1231.92 g/mol |
| Exact Mass | 1231.03 |
| IUPAC Name | nonyl 8-[2-[bis[6-[4,4-bis[(Z)-oct-5-enoxy]butanoyloxy]hexyl]amino]ethyl-(3-hydroxypropyl)amino]octanoate |
| SMILES | CC/C=C\CCCCOC(CCC(=O)OCCCCCCN(CCCCCCOC(=O)CCC(OCCCC/C=C\CC)OCCCC/C=C\CC)CCN(CCCO)CCCCCCCC(=O)OCCCCCCCCC)OCCCC/C=C\CC |
| InChI | InChI=1S/C74H138N2O11/c1-6-11-16-21-26-36-43-63-81-70(78)51-39-28-27-29-40-58-76(59-50-62-77)61-60-75(56-41-30-37-44-64-82-71(79)52-54-73(84-66-46-32-22-17-12-7-2)85-67-47-33-23-18-13-8-3)57-42-31-38-45-65-83-72(80)53-55-74(86-68-48-34-24-19-14-9-4)87-69-49-35-25-20-15-10-5/h12-15,17-20,73-74,77H,6-11,16,21-69H2,1-5H3/b17-12-,18-13-,19-14-,20-15- |
| InChIKey | MZSHHIWFIJRRPF-PGDWMVRZSA-N |
| XLogP | 18.64 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 70 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1231.92 |
| LogP ≤ 5 | 18.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|