C91H175N3O8 — CID 170179848
4-[3-[1-[2-[bis[4-(2-hexyldecanoyloxy)butyl]amino]ethyl]-2,3,6,7-tetrahydroazepin-4-yl]propyl-[4-(2-hexyldecanoyloxy)butyl]amino]butyl 2-hexyldecanoate (PubChem CID 170179848) has the molecular formula C91H175N3O8 and a molecular weight of 1439.41 g/mol. Its IUPAC name is 4-[3-[1-[2-[bis[4-(2-hexyldecanoyloxy)butyl]amino]ethyl]-2,3,6,7-tetrahydroazepin-4-yl]propyl-[4-(2-hexyldecanoyloxy)butyl]amino]butyl 2-hexyldecanoate.
| Compound Name | 4-[3-[1-[2-[bis[4-(2-hexyldecanoyloxy)butyl]amino]ethyl]-2,3,6,7-tetrahydroazepin-4-yl]propyl-[4-(2-hexyldecanoyloxy)butyl]amino]butyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 170179848 |
| Molecular Formula | C91H175N3O8 |
| Molecular Weight | 1439.41 g/mol |
| Exact Mass | 1438.34 |
| IUPAC Name | 4-[3-[1-[2-[bis[4-(2-hexyldecanoyloxy)butyl]amino]ethyl]-2,3,6,7-tetrahydroazepin-4-yl]propyl-[4-(2-hexyldecanoyloxy)butyl]amino]butyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCN(CCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCC1=CCCN(CCN(CCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCCOC(=O)C(CCCCCC)CCCCCCCC)CC1 |
| InChI | InChI=1S/C91H175N3O8/c1-9-17-25-33-37-45-65-84(61-41-29-21-13-5)88(95)99-79-53-49-70-92(71-50-54-80-100-89(96)85(62-42-30-22-14-6)66-46-38-34-26-18-10-2)74-57-59-83-60-58-75-94(76-69-83)78-77-93(72-51-55-81-101-90(97)86(63-43-31-23-15-7)67-47-39-35-27-19-11-3)73-52-56-82-102-91(98)87(64-44-32-24-16-8)68-48-40-36-28-20-12-4/h60,84-87H,9-59,61-82H2,1-8H3 |
| InChIKey | YZSMWAPNOCBQQU-UHFFFAOYSA-N |
| XLogP | 26.04 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 79 |
| Heavy Atoms | 102 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1439.41 |
| LogP ≤ 5 | 26.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|