C49H97N3O5 — CID 171808097
3-pentyldecyl 6-hydroxy-7-[2-[methyl(methyliminomethyl)amino]ethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate (PubChem CID 171808097) has the molecular formula C49H97N3O5 and a molecular weight of 808.33 g/mol. Its IUPAC name is 3-pentyldecyl 6-hydroxy-7-[2-[methyl(methyliminomethyl)amino]ethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate.
| Compound Name | 3-pentyldecyl 6-hydroxy-7-[2-[methyl(methyliminomethyl)amino]ethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate |
|---|---|
| PubChem CID | 171808097 |
| Molecular Formula | C49H97N3O5 |
| Molecular Weight | 808.33 g/mol |
| Exact Mass | 807.74 |
| IUPAC Name | 3-pentyldecyl 6-hydroxy-7-[2-[methyl(methyliminomethyl)amino]ethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]heptanoate |
| SMILES | CCCCCCCC(CCCCC)CCOC(=O)CCCCCCN(CCN(C)/C=N/C)CC(O)CCCCC(=O)OCCC(CCCCC)CCCCCCC |
| InChI | InChI=1S/C49H97N3O5/c1-7-11-15-17-23-31-45(29-21-13-9-3)36-41-56-48(54)34-25-19-20-28-38-52(40-39-51(6)44-50-5)43-47(53)33-26-27-35-49(55)57-42-37-46(30-22-14-10-4)32-24-18-16-12-8-2/h44-47,53H,7-43H2,1-6H3/b50-44+ |
| InChIKey | ORJIVHPZZXTTHN-PBFCBGGQSA-N |
| XLogP | 12.73 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.33 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|