C47H93NO6 — CID 174364235
3-pentyldecyl 7-hydroxy-6-[[2-hydroxyethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]methyl]heptanoate (PubChem CID 174364235) has the molecular formula C47H93NO6 and a molecular weight of 768.26 g/mol. Its IUPAC name is 3-pentyldecyl 7-hydroxy-6-[[2-hydroxyethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]methyl]heptanoate.
| Compound Name | 3-pentyldecyl 7-hydroxy-6-[[2-hydroxyethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]methyl]heptanoate |
|---|---|
| PubChem CID | 174364235 |
| Molecular Formula | C47H93NO6 |
| Molecular Weight | 768.26 g/mol |
| Exact Mass | 767.70 |
| IUPAC Name | 3-pentyldecyl 7-hydroxy-6-[[2-hydroxyethyl-[7-oxo-7-(3-pentyldecoxy)heptyl]amino]methyl]heptanoate |
| SMILES | CCCCCCCC(CCCCC)CCOC(=O)CCCCCCN(CCO)CC(CO)CCCCC(=O)OCCC(CCCCC)CCCCCCC |
| InChI | InChI=1S/C47H93NO6/c1-5-9-13-15-21-29-43(27-19-11-7-3)34-39-53-46(51)32-23-17-18-26-36-48(37-38-49)41-45(42-50)31-24-25-33-47(52)54-40-35-44(28-20-12-8-4)30-22-16-14-10-6-2/h43-45,49-50H,5-42H2,1-4H3 |
| InChIKey | WBZJUVPDYJNEGE-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.26 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|