C44H87NO5 — CID 176602877
nonyl 8-[[8-(3-hexylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]-6,6-dimethyloctanoate (PubChem CID 176602877) has the molecular formula C44H87NO5 and a molecular weight of 710.18 g/mol. Its IUPAC name is nonyl 8-[[8-(3-hexylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]-6,6-dimethyloctanoate.
| Compound Name | nonyl 8-[[8-(3-hexylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]-6,6-dimethyloctanoate |
|---|---|
| PubChem CID | 176602877 |
| Molecular Formula | C44H87NO5 |
| Molecular Weight | 710.18 g/mol |
| Exact Mass | 709.66 |
| IUPAC Name | nonyl 8-[[8-(3-hexylnonoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]-6,6-dimethyloctanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCC(C)(C)CCN(CCO)CCCCCCCC(=O)OCCC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C44H87NO5/c1-6-9-12-15-16-20-27-39-49-42(47)31-24-25-33-44(4,5)34-36-45(37-38-46)35-26-19-17-18-23-30-43(48)50-40-32-41(28-21-13-10-7-2)29-22-14-11-8-3/h41,46H,6-40H2,1-5H3 |
| InChIKey | KJFZAUZQEXAGRU-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.18 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|