C47H93NO5 — CID 176602902
[7-[[7-(3-heptyldecoxy)-7-oxoheptyl]-(4-hydroxybutyl)amino]-3,3-dimethylheptyl] decanoate (PubChem CID 176602902) has the molecular formula C47H93NO5 and a molecular weight of 752.26 g/mol. Its IUPAC name is [7-[[7-(3-heptyldecoxy)-7-oxoheptyl]-(4-hydroxybutyl)amino]-3,3-dimethylheptyl] decanoate.
| Compound Name | [7-[[7-(3-heptyldecoxy)-7-oxoheptyl]-(4-hydroxybutyl)amino]-3,3-dimethylheptyl] decanoate |
|---|---|
| PubChem CID | 176602902 |
| Molecular Formula | C47H93NO5 |
| Molecular Weight | 752.26 g/mol |
| Exact Mass | 751.71 |
| IUPAC Name | [7-[[7-(3-heptyldecoxy)-7-oxoheptyl]-(4-hydroxybutyl)amino]-3,3-dimethylheptyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCCC(C)(C)CCCCN(CCCCO)CCCCCCC(=O)OCCC(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C47H93NO5/c1-6-9-12-15-16-19-24-34-46(51)53-43-37-47(4,5)36-26-28-39-48(40-29-30-41-49)38-27-21-20-25-33-45(50)52-42-35-44(31-22-17-13-10-7-2)32-23-18-14-11-8-3/h44,49H,6-43H2,1-5H3 |
| InChIKey | FNDWFHYKYILWKC-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.26 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|