C46H91NO5 — CID 176602846
[7-[[7-(3-heptyldecoxy)-7-oxoheptyl]-(3-hydroxypropyl)amino]-2,2-dimethylheptyl] decanoate (PubChem CID 176602846) has the molecular formula C46H91NO5 and a molecular weight of 738.24 g/mol. Its IUPAC name is [7-[[7-(3-heptyldecoxy)-7-oxoheptyl]-(3-hydroxypropyl)amino]-2,2-dimethylheptyl] decanoate.
| Compound Name | [7-[[7-(3-heptyldecoxy)-7-oxoheptyl]-(3-hydroxypropyl)amino]-2,2-dimethylheptyl] decanoate |
|---|---|
| PubChem CID | 176602846 |
| Molecular Formula | C46H91NO5 |
| Molecular Weight | 738.24 g/mol |
| Exact Mass | 737.69 |
| IUPAC Name | [7-[[7-(3-heptyldecoxy)-7-oxoheptyl]-(3-hydroxypropyl)amino]-2,2-dimethylheptyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(C)(C)CCCCCN(CCCO)CCCCCCC(=O)OCCC(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C46H91NO5/c1-6-9-12-15-16-19-25-34-45(50)52-42-46(4,5)36-27-22-29-38-47(39-30-40-48)37-28-21-20-26-33-44(49)51-41-35-43(31-23-17-13-10-7-2)32-24-18-14-11-8-3/h43,48H,6-42H2,1-5H3 |
| InChIKey | FQNHGADRYWQOOV-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.24 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|