C41H81NO5 — CID 176602861
nonyl 8-[2-hydroxyethyl-[8-oxo-8-(6-propylnonoxy)octyl]amino]-2,2-dimethyloctanoate (PubChem CID 176602861) has the molecular formula C41H81NO5 and a molecular weight of 668.10 g/mol. Its IUPAC name is nonyl 8-[2-hydroxyethyl-[8-oxo-8-(6-propylnonoxy)octyl]amino]-2,2-dimethyloctanoate.
| Compound Name | nonyl 8-[2-hydroxyethyl-[8-oxo-8-(6-propylnonoxy)octyl]amino]-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 176602861 |
| Molecular Formula | C41H81NO5 |
| Molecular Weight | 668.10 g/mol |
| Exact Mass | 667.61 |
| IUPAC Name | nonyl 8-[2-hydroxyethyl-[8-oxo-8-(6-propylnonoxy)octyl]amino]-2,2-dimethyloctanoate |
| SMILES | CCCCCCCCCOC(=O)C(C)(C)CCCCCCN(CCO)CCCCCCCC(=O)OCCCCCC(CCC)CCC |
| InChI | InChI=1S/C41H81NO5/c1-6-9-10-11-12-18-25-37-47-40(45)41(4,5)31-22-15-17-24-33-42(34-35-43)32-23-16-13-14-21-30-39(44)46-36-26-19-20-29-38(27-7-2)28-8-3/h38,43H,6-37H2,1-5H3 |
| InChIKey | UDJIRFLWFPEMBB-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.10 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|