C40H78O5 — CID 176756129
1-O-nonyl 15-O-(4-pentylnonyl) 8-hydroxy-2,2-dimethylpentadecanedioate (PubChem CID 176756129) has the molecular formula C40H78O5 and a molecular weight of 639.06 g/mol. Its IUPAC name is 1-O-nonyl 15-O-(4-pentylnonyl) 8-hydroxy-2,2-dimethylpentadecanedioate.
| Compound Name | 1-O-nonyl 15-O-(4-pentylnonyl) 8-hydroxy-2,2-dimethylpentadecanedioate |
|---|---|
| PubChem CID | 176756129 |
| Molecular Formula | C40H78O5 |
| Molecular Weight | 639.06 g/mol |
| Exact Mass | 638.58 |
| IUPAC Name | 1-O-nonyl 15-O-(4-pentylnonyl) 8-hydroxy-2,2-dimethylpentadecanedioate |
| SMILES | CCCCCCCCCOC(=O)C(C)(C)CCCCCC(O)CCCCCCC(=O)OCCCC(CCCCC)CCCCC |
| InChI | InChI=1S/C40H78O5/c1-6-9-12-13-14-17-25-34-45-39(43)40(4,5)33-24-18-22-31-37(41)30-21-15-16-23-32-38(42)44-35-26-29-36(27-19-10-7-2)28-20-11-8-3/h36-37,41H,6-35H2,1-5H3 |
| InChIKey | QEJWUTXJDABHDP-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.06 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|