C46H89NO6 — CID 176756095
15-O-nonyl 1-O-(4-pentylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2-dimethylpentadecanedioate (PubChem CID 176756095) has the molecular formula C46H89NO6 and a molecular weight of 752.22 g/mol. Its IUPAC name is 15-O-nonyl 1-O-(4-pentylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2-dimethylpentadecanedioate.
| Compound Name | 15-O-nonyl 1-O-(4-pentylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2-dimethylpentadecanedioate |
|---|---|
| PubChem CID | 176756095 |
| Molecular Formula | C46H89NO6 |
| Molecular Weight | 752.22 g/mol |
| Exact Mass | 751.67 |
| IUPAC Name | 15-O-nonyl 1-O-(4-pentylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2-dimethylpentadecanedioate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCC(CCCCCC(C)(C)C(=O)OCCCC(CCCCC)CCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C46H89NO6/c1-8-11-14-15-16-19-27-39-51-43(48)35-25-18-17-23-33-42(53-44(49)36-28-38-47(6)7)34-24-20-26-37-46(4,5)45(50)52-40-29-32-41(30-21-12-9-2)31-22-13-10-3/h41-42H,8-40H2,1-7H3 |
| InChIKey | SZLGBVCEOFPEJU-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.22 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|