C57H111NO6 — CID 169321460
bis(2-heptylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2,14,14-tetramethylpentadecanedioate (PubChem CID 169321460) has the molecular formula C57H111NO6 and a molecular weight of 906.52 g/mol. Its IUPAC name is bis(2-heptylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2,14,14-tetramethylpentadecanedioate.
| Compound Name | bis(2-heptylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2,14,14-tetramethylpentadecanedioate |
|---|---|
| PubChem CID | 169321460 |
| Molecular Formula | C57H111NO6 |
| Molecular Weight | 906.52 g/mol |
| Exact Mass | 905.84 |
| IUPAC Name | bis(2-heptylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2,14,14-tetramethylpentadecanedioate |
| SMILES | CCCCCCCC(CCCCCCC)COC(=O)C(C)(C)CCCCCC(CCCCCC(C)(C)C(=O)OCC(CCCCCCC)CCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C57H111NO6/c1-11-15-19-23-29-38-50(39-30-24-20-16-12-2)48-62-54(60)56(5,6)45-35-27-33-42-52(64-53(59)44-37-47-58(9)10)43-34-28-36-46-57(7,8)55(61)63-49-51(40-31-25-21-17-13-3)41-32-26-22-18-14-4/h50-52H,11-49H2,1-10H3 |
| InChIKey | MTVKZPRAYPDARI-UHFFFAOYSA-N |
| XLogP | 16.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.52 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|