C53H103NO6 — CID 169321401
bis(4-pentylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2,14,14-tetramethylpentadecanedioate (PubChem CID 169321401) has the molecular formula C53H103NO6 and a molecular weight of 850.41 g/mol. Its IUPAC name is bis(4-pentylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2,14,14-tetramethylpentadecanedioate.
| Compound Name | bis(4-pentylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2,14,14-tetramethylpentadecanedioate |
|---|---|
| PubChem CID | 169321401 |
| Molecular Formula | C53H103NO6 |
| Molecular Weight | 850.41 g/mol |
| Exact Mass | 849.78 |
| IUPAC Name | bis(4-pentylnonyl) 8-[4-(dimethylamino)butanoyloxy]-2,2,14,14-tetramethylpentadecanedioate |
| SMILES | CCCCCC(CCCCC)CCCOC(=O)C(C)(C)CCCCCC(CCCCCC(C)(C)C(=O)OCCCC(CCCCC)CCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C53H103NO6/c1-11-15-21-32-46(33-22-16-12-2)36-30-44-58-50(56)52(5,6)41-27-19-25-38-48(60-49(55)40-29-43-54(9)10)39-26-20-28-42-53(7,8)51(57)59-45-31-37-47(34-23-17-13-3)35-24-18-14-4/h46-48H,11-45H2,1-10H3 |
| InChIKey | YGFDRZDWMOEHGM-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.41 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|