C40H77NO6 — CID 169321424
dioctyl 8-[3-(dimethylamino)propanoyloxy]-2,2,14,14-tetramethylpentadecanedioate (PubChem CID 169321424) has the molecular formula C40H77NO6 and a molecular weight of 668.06 g/mol. Its IUPAC name is dioctyl 8-[3-(dimethylamino)propanoyloxy]-2,2,14,14-tetramethylpentadecanedioate.
| Compound Name | dioctyl 8-[3-(dimethylamino)propanoyloxy]-2,2,14,14-tetramethylpentadecanedioate |
|---|---|
| PubChem CID | 169321424 |
| Molecular Formula | C40H77NO6 |
| Molecular Weight | 668.06 g/mol |
| Exact Mass | 667.58 |
| IUPAC Name | dioctyl 8-[3-(dimethylamino)propanoyloxy]-2,2,14,14-tetramethylpentadecanedioate |
| SMILES | CCCCCCCCOC(=O)C(C)(C)CCCCCC(CCCCCC(C)(C)C(=O)OCCCCCCCC)OC(=O)CCN(C)C |
| InChI | InChI=1S/C40H77NO6/c1-9-11-13-15-17-25-33-45-37(43)39(3,4)30-23-19-21-27-35(47-36(42)29-32-41(7)8)28-22-20-24-31-40(5,6)38(44)46-34-26-18-16-14-12-10-2/h35H,9-34H2,1-8H3 |
| InChIKey | FDEGEEKBWVRUBA-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.06 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|