C48H93NO5 — CID 170362259
1-O-decyl 13-O-(2-pentylnonyl) 7-[5-(dimethylamino)pent-1-en-2-yloxy]-2,2,12,12-tetramethyltridecanedioate (PubChem CID 170362259) has the molecular formula C48H93NO5 and a molecular weight of 764.27 g/mol. Its IUPAC name is 1-O-decyl 13-O-(2-pentylnonyl) 7-[5-(dimethylamino)pent-1-en-2-yloxy]-2,2,12,12-tetramethyltridecanedioate.
| Compound Name | 1-O-decyl 13-O-(2-pentylnonyl) 7-[5-(dimethylamino)pent-1-en-2-yloxy]-2,2,12,12-tetramethyltridecanedioate |
|---|---|
| PubChem CID | 170362259 |
| Molecular Formula | C48H93NO5 |
| Molecular Weight | 764.27 g/mol |
| Exact Mass | 763.71 |
| IUPAC Name | 1-O-decyl 13-O-(2-pentylnonyl) 7-[5-(dimethylamino)pent-1-en-2-yloxy]-2,2,12,12-tetramethyltridecanedioate |
| SMILES | C=C(CCCN(C)C)OC(CCCCC(C)(C)C(=O)OCCCCCCCCCC)CCCCC(C)(C)C(=O)OCC(CCCCC)CCCCCCC |
| InChI | InChI=1S/C48H93NO5/c1-11-14-17-19-20-21-23-30-40-52-45(50)47(5,6)37-28-26-35-44(54-42(4)32-31-39-49(9)10)36-27-29-38-48(7,8)46(51)53-41-43(33-24-16-13-3)34-25-22-18-15-12-2/h43-44H,4,11-41H2,1-3,5-10H3 |
| InChIKey | BDIQRZJHBBRHJK-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.27 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|